CAS 500302-20-5 is the registry number for 2,4–Difluoro–N–(2–nitrophenyl)aniline. Offered by: GLPBio. Available pack sizes: 1g, 5g.
2,4-difluoro-N-(2-nitrophenyl)aniline (CAS 500302-20-5) is a chemical compound with the molecular formula C12H8F2N2O2 and a molecular weight of 250.20 g/mol. IUPAC name: 2,4-difluoro-N-(2-nitrophenyl)aniline. InChIKey: WMLCAYVRBXFGDX-UHFFFAOYSA-N.
| Molecular formula | C12H8F2N2O2 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | 2,4-difluoro-N-(2-nitrophenyl)aniline |
| InChIKey | WMLCAYVRBXFGDX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=C(C=C(C=C2)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)