CAS 1019340-50-1 is the registry number for 1-(4-Isopropyloxybenzoyl)-3,3,3-trifluoroacetone, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4,4,4-trifluoro-1-(4-propan-2-yloxyphenyl)butane-1,3-dione (CAS 1019340-50-1) is a chemical compound with the molecular formula C13H13F3O3 and a molecular weight of 274.23 g/mol. IUPAC name: 4,4,4-trifluoro-1-(4-propan-2-yloxyphenyl)butane-1,3-dione. InChIKey: OJNXOCCHMILCIT-UHFFFAOYSA-N.
| Molecular formula | C13H13F3O3 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(4-propan-2-yloxyphenyl)butane-1,3-dione |
| InChIKey | OJNXOCCHMILCIT-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)