Products 1035261-84-7

CAS 1035261-84-7 is the registry number for 4-(3-(Trifluoromethyl)phenyl)oxane-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-[3-(trifluoromethyl)phenyl]oxane-4-carboxylic acid (CAS 1035261-84-7) is a chemical compound with the molecular formula C13H13F3O3 and a molecular weight of 274.23 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenyl]oxane-4-carboxylic acid. InChIKey: CKZJJQRWWKDAHA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13F3O3
Molecular weight274.23 g/mol
IUPAC name4-[3-(trifluoromethyl)phenyl]oxane-4-carboxylic acid
InChIKeyCKZJJQRWWKDAHA-UHFFFAOYSA-N
SMILESC1COCCC1(C2=CC(=CC=C2)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)