CAS 2108039-73-0 is the registry number for Ethyl 6-(trifluoromethyl)chromane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylate (CAS 2108039-73-0) is a chemical compound with the molecular formula C13H13F3O3 and a molecular weight of 274.23 g/mol. IUPAC name: ethyl 6-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylate. InChIKey: QLZVZMBXFLCHGV-UHFFFAOYSA-N.
| Molecular formula | C13H13F3O3 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | ethyl 6-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylate |
| InChIKey | QLZVZMBXFLCHGV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(C=CC(=C2)C(F)(F)F)OC1 |
Computed by PubChem (NCBI)