Products 1019342-90-5

CAS 1019342-90-5 is the registry number for 1-(1,1-Dioxidotetrahydrothiophen-3-yl)-1H-benzo[d][1,2,3]triazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(1,1-dioxothiolan-3-yl)benzotriazole-5-carboxylic acid (CAS 1019342-90-5) is a chemical compound with the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)benzotriazole-5-carboxylic acid. InChIKey: GURFSSSQYJKUSC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11N3O4S
Molecular weight281.29 g/mol
IUPAC name1-(1,1-dioxothiolan-3-yl)benzotriazole-5-carboxylic acid
InChIKeyGURFSSSQYJKUSC-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1N2C3=C(C=C(C=C3)C(=O)O)N=N2

Computed by PubChem (NCBI)