Products 58460-45-0
CAS 58460-45-0 appears in our catalog under these names: Cefacetrile Impurity 3, Desacetoxy Cefacetrile. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(6R,7R)-7-[(2-cyanoacetyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 58460-45-0) is a chemical compound with the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. IUPAC name: (6R,7R)-7-[(2-cyanoacetyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: QBQBMONZPBOWQW-GMSGAONNSA-N.
| Molecular formula | C11H11N3O4S |
|---|---|
| Molecular weight | 281.29 g/mol |
| IUPAC name | (6R,7R)-7-[(2-cyanoacetyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | QBQBMONZPBOWQW-GMSGAONNSA-N |
| SMILES | CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)CC#N)SC1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Desacetoxy Cefacetrile