Products 1544711-22-9
CAS 1544711-22-9 is the registry number for 1-(1,1-Dioxidotetrahydrothiophen-3-yl)-1H-benzo[d][1,2,3]triazole-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1-dioxothiolan-3-yl)benzotriazole-5-carboxylic acid (CAS 1544711-22-9) is a chemical compound with the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. IUPAC name: 3-(1,1-dioxothiolan-3-yl)benzotriazole-5-carboxylic acid. InChIKey: NLFJYQIZORDVOP-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O4S |
|---|---|
| Molecular weight | 281.29 g/mol |
| IUPAC name | 3-(1,1-dioxothiolan-3-yl)benzotriazole-5-carboxylic acid |
| InChIKey | NLFJYQIZORDVOP-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2C3=C(C=CC(=C3)C(=O)O)N=N2 |
Computed by PubChem (NCBI)