CAS 892874-30-5 is the registry number for 2-(5-Methanesulfonyl-3-phenyl-[1,2,4]triazol-4-yl)-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3-methylsulfonyl-5-phenyl-1,2,4-triazol-4-yl)acetic acid (CAS 892874-30-5) is a chemical compound with the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. IUPAC name: 2-(3-methylsulfonyl-5-phenyl-1,2,4-triazol-4-yl)acetic acid. InChIKey: KSVAMMCIUJYEPD-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O4S |
|---|---|
| Molecular weight | 281.29 g/mol |
| IUPAC name | 2-(3-methylsulfonyl-5-phenyl-1,2,4-triazol-4-yl)acetic acid |
| InChIKey | KSVAMMCIUJYEPD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NN=C(N1CC(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)