CAS 1019343-45-3 appears in our catalog under these names: 4-Hydroxy-N-(2,2,2-trifluoroethyl)benzamide, 95%, 4-Hydroxy-N-(2,2,2-trifluoroethyl)benzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
4-hydroxy-N-(2,2,2-trifluoroethyl)benzamide (CAS 1019343-45-3) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 4-hydroxy-N-(2,2,2-trifluoroethyl)benzamide. InChIKey: PZEGPNCTRXXCPP-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 4-hydroxy-N-(2,2,2-trifluoroethyl)benzamide |
| InChIKey | PZEGPNCTRXXCPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(F)(F)F)O |
Computed by PubChem (NCBI)