Products 1019353-72-0
CAS 1019353-72-0 appears in our catalog under these names: 2-((3-Hydroxyphenyl)formamido)acetamide, 95%, 2-((3-Hydroxyphenyl)formamido)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
N-(2-amino-2-oxoethyl)-3-hydroxybenzamide (CAS 1019353-72-0) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: N-(2-amino-2-oxoethyl)-3-hydroxybenzamide. InChIKey: PBRAZFGTELTCJA-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | N-(2-amino-2-oxoethyl)-3-hydroxybenzamide |
| InChIKey | PBRAZFGTELTCJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(=O)NCC(=O)N |
Computed by PubChem (NCBI)