CAS 101937-67-1 appears in our catalog under these names: 2-([(4-Chlorophenyl)amino]carbonyl)cyclohexanecarboxylic acid, 95%, 2-{((4-Chlorophenyl)amino)carbonyl}cyclohexanecarboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 25mg, 10mg, 50mg.
2-[(4-chlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid (CAS 101937-67-1) is a chemical compound with the molecular formula C14H16ClNO3 and a molecular weight of 281.73 g/mol. IUPAC name: 2-[(4-chlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid. InChIKey: CANPECYEYBATAJ-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO3 |
|---|---|
| Molecular weight | 281.73 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| InChIKey | CANPECYEYBATAJ-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)C(=O)NC2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)