CAS 2270904-95-3 is the registry number for 2-Amino-3-(6-methoxy-naphthalen-2-yl)-propionic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-amino-3-(6-methoxynaphthalen-2-yl)propanoic acid;hydrochloride (CAS 2270904-95-3) is a chemical compound with the molecular formula C14H16ClNO3 and a molecular weight of 281.73 g/mol. IUPAC name: 2-amino-3-(6-methoxynaphthalen-2-yl)propanoic acid;hydrochloride. InChIKey: VZPAYQHAQUEKIR-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO3 |
|---|---|
| Molecular weight | 281.73 g/mol |
| IUPAC name | 2-amino-3-(6-methoxynaphthalen-2-yl)propanoic acid;hydrochloride |
| InChIKey | VZPAYQHAQUEKIR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)