Products 1177362-09-2

CAS 1177362-09-2 is the registry number for Methyl 5-[(benzylamino)methyl]-2-furoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 5-[(benzylamino)methyl]furan-2-carboxylate;hydrochloride (CAS 1177362-09-2) is a chemical compound with the molecular formula C14H16ClNO3 and a molecular weight of 281.73 g/mol. IUPAC name: methyl 5-[(benzylamino)methyl]furan-2-carboxylate;hydrochloride. InChIKey: BIIBGZOWGFELSU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16ClNO3
Molecular weight281.73 g/mol
IUPAC namemethyl 5-[(benzylamino)methyl]furan-2-carboxylate;hydrochloride
InChIKeyBIIBGZOWGFELSU-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(O1)CNCC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)