CAS 1019395-20-0 is the registry number for N-(3,4-Difluorophenyl)-3-hydroxybenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(3,4-difluorophenyl)-3-hydroxybenzamide (CAS 1019395-20-0) is a chemical compound with the molecular formula C13H9F2NO2 and a molecular weight of 249.21 g/mol. IUPAC name: N-(3,4-difluorophenyl)-3-hydroxybenzamide. InChIKey: FEXLLWNRONWVCA-UHFFFAOYSA-N.
| Molecular formula | C13H9F2NO2 |
|---|---|
| Molecular weight | 249.21 g/mol |
| IUPAC name | N-(3,4-difluorophenyl)-3-hydroxybenzamide |
| InChIKey | FEXLLWNRONWVCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(=O)NC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)