Products 1365273-04-6
CAS 1365273-04-6 is the registry number for Methyl 3-fluoro-5-(3-fluoropyridin-2-yl)benzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 3-fluoro-5-(3-fluoro-2-pyridinyl)benzoate (CAS 1365273-04-6) is a chemical compound with the molecular formula C13H9F2NO2 and a molecular weight of 249.21 g/mol. IUPAC name: methyl 3-fluoro-5-(3-fluoro-2-pyridinyl)benzoate. InChIKey: KLKCIBLYZCJPLZ-UHFFFAOYSA-N.
| Molecular formula | C13H9F2NO2 |
|---|---|
| Molecular weight | 249.21 g/mol |
| IUPAC name | methyl 3-fluoro-5-(3-fluoro-2-pyridinyl)benzoate |
| InChIKey | KLKCIBLYZCJPLZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C2=C(C=CC=N2)F)F |
Computed by PubChem (NCBI)