Products 1210419-52-5

CAS 1210419-52-5 is the registry number for 6-(2,6-Difluoro-3-methylphenyl)picolinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-(2,6-difluoro-3-methylphenyl)pyridine-2-carboxylic acid (CAS 1210419-52-5) is a chemical compound with the molecular formula C13H9F2NO2 and a molecular weight of 249.21 g/mol. IUPAC name: 6-(2,6-difluoro-3-methylphenyl)pyridine-2-carboxylic acid. InChIKey: CNEGGCAGRLSHFR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9F2NO2
Molecular weight249.21 g/mol
IUPAC name6-(2,6-difluoro-3-methylphenyl)pyridine-2-carboxylic acid
InChIKeyCNEGGCAGRLSHFR-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)F)C2=NC(=CC=C2)C(=O)O)F

Computed by PubChem (NCBI)