CAS 1019459-07-4 is the registry number for 3-Methyl-2-(5-phenyl-2H-1,2,3,4-tetrazol-2-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-methyl-2-(5-phenyltetrazol-2-yl)butanoic acid (CAS 1019459-07-4) is a chemical compound with the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. IUPAC name: 3-methyl-2-(5-phenyltetrazol-2-yl)butanoic acid. InChIKey: FGAZTRCSRQPMET-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O2 |
|---|---|
| Molecular weight | 246.27 g/mol |
| IUPAC name | 3-methyl-2-(5-phenyltetrazol-2-yl)butanoic acid |
| InChIKey | FGAZTRCSRQPMET-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)N1N=C(N=N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)