CAS 1019462-46-4 is the registry number for (2-Chloro-4-fluorophenyl)(4-methylphenyl)methanamine. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
(2-chloro-4-fluorophenyl)-(4-methylphenyl)methanamine (CAS 1019462-46-4) is a chemical compound with the molecular formula C14H13ClFN and a molecular weight of 249.71 g/mol. IUPAC name: (2-chloro-4-fluorophenyl)-(4-methylphenyl)methanamine. InChIKey: LHJDDAZELIIHFJ-UHFFFAOYSA-N.
| Molecular formula | C14H13ClFN |
|---|---|
| Molecular weight | 249.71 g/mol |
| IUPAC name | (2-chloro-4-fluorophenyl)-(4-methylphenyl)methanamine |
| InChIKey | LHJDDAZELIIHFJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=C(C=C(C=C2)F)Cl)N |
Computed by PubChem (NCBI)