CAS 1909337-08-1 appears in our catalog under these names: 9-Chloro-8-fluoro-7-methyl-1,2,3,4-tetrahydroacridine, 95%, 9-Chloro-8-fluoro-7-methyl-1,2,3,4-tetrahydroacridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
9-chloro-8-fluoro-7-methyl-1,2,3,4-tetrahydroacridine (CAS 1909337-08-1) is a chemical compound with the molecular formula C14H13ClFN and a molecular weight of 249.71 g/mol. IUPAC name: 9-chloro-8-fluoro-7-methyl-1,2,3,4-tetrahydroacridine. InChIKey: KNRCAMFSOZPJPX-UHFFFAOYSA-N.
| Molecular formula | C14H13ClFN |
|---|---|
| Molecular weight | 249.71 g/mol |
| IUPAC name | 9-chloro-8-fluoro-7-methyl-1,2,3,4-tetrahydroacridine |
| InChIKey | KNRCAMFSOZPJPX-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)N=C3CCCCC3=C2Cl)F |
Computed by PubChem (NCBI)