CAS 1354959-99-1 appears in our catalog under these names: 5-(3-Fluorophenyl)-2,3-dihydro-1H-indole hydrochloride, 95%, 5-(3-Fluorophenyl)-2,3-dihydro-1H-indole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(3-fluorophenyl)-2,3-dihydro-1H-indole;hydrochloride (CAS 1354959-99-1) is a chemical compound with the molecular formula C14H13ClFN and a molecular weight of 249.71 g/mol. IUPAC name: 5-(3-fluorophenyl)-2,3-dihydro-1H-indole;hydrochloride. InChIKey: VJBIROJQEWTEIC-UHFFFAOYSA-N.
| Molecular formula | C14H13ClFN |
|---|---|
| Molecular weight | 249.71 g/mol |
| IUPAC name | 5-(3-fluorophenyl)-2,3-dihydro-1H-indole;hydrochloride |
| InChIKey | VJBIROJQEWTEIC-UHFFFAOYSA-N |
| SMILES | C1CNC2=C1C=C(C=C2)C3=CC(=CC=C3)F.Cl |
Computed by PubChem (NCBI)