CAS 1019484-08-2 is the registry number for 3-(((5-Bromothiophen-2-yl)methyl)amino)tetrahydrothiophene 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(5-bromothiophen-2-yl)methyl]-1,1-dioxothiolan-3-amine (CAS 1019484-08-2) is a chemical compound with the molecular formula C9H12BrNO2S2 and a molecular weight of 310.2 g/mol. IUPAC name: N-[(5-bromothiophen-2-yl)methyl]-1,1-dioxothiolan-3-amine. InChIKey: HQFWJRGNCUNOJF-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2S2 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | N-[(5-bromothiophen-2-yl)methyl]-1,1-dioxothiolan-3-amine |
| InChIKey | HQFWJRGNCUNOJF-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NCC2=CC=C(S2)Br |
Computed by PubChem (NCBI)