CAS 1333953-58-4 is the registry number for N-{2-((3-Bromophenyl)sulfanyl)ethyl}methanesulfonamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
N-[2-(3-bromophenyl)sulfanylethyl]methanesulfonamide (CAS 1333953-58-4) is a chemical compound with the molecular formula C9H12BrNO2S2 and a molecular weight of 310.2 g/mol. IUPAC name: N-[2-(3-bromophenyl)sulfanylethyl]methanesulfonamide. InChIKey: BOKUQIUNVXEZHH-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2S2 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | N-[2-(3-bromophenyl)sulfanylethyl]methanesulfonamide |
| InChIKey | BOKUQIUNVXEZHH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NCCSC1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)