CAS 851199-47-8 is the registry number for N-[2-(4-Bromo-phenyl sulfanyl)-ethyl]-methanesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[2-(4-bromophenyl)sulfanylethyl]methanesulfonamide (CAS 851199-47-8) is a chemical compound with the molecular formula C9H12BrNO2S2 and a molecular weight of 310.2 g/mol. IUPAC name: N-[2-(4-bromophenyl)sulfanylethyl]methanesulfonamide. InChIKey: FTAOYAPKKQTPNT-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2S2 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | N-[2-(4-bromophenyl)sulfanylethyl]methanesulfonamide |
| InChIKey | FTAOYAPKKQTPNT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NCCSC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)