CAS 1019573-28-4 appears in our catalog under these names: 3-{((quinolin-8-yl)amino)methyl}phenol, 95%, 3-{((Quinolin-8-yl)amino)methyl}phenol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-[(quinolin-8-ylamino)methyl]phenol (CAS 1019573-28-4) is a chemical compound with the molecular formula C16H14N2O and a molecular weight of 250.29 g/mol. IUPAC name: 3-[(quinolin-8-ylamino)methyl]phenol. InChIKey: GITKOBMDTPUIFX-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 3-[(quinolin-8-ylamino)methyl]phenol |
| InChIKey | GITKOBMDTPUIFX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)NCC3=CC(=CC=C3)O)N=CC=C2 |
Computed by PubChem (NCBI)