CAS 300393-11-7 appears in our catalog under these names: 1-[3-(1-Imino-1,3-dihydro-2h-isoindol-2-yl)phenyl]ethanone, 95%, 1-(3-(1-Imino-2,3-dihydro-1H-isoindol-2-yl)phenyl)ethan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-[3-(3-imino-1H-isoindol-2-yl)phenyl]ethanone (CAS 300393-11-7) is a chemical compound with the molecular formula C16H14N2O and a molecular weight of 250.29 g/mol. IUPAC name: 1-[3-(3-imino-1H-isoindol-2-yl)phenyl]ethanone. InChIKey: WRDGMMDGYNHYCU-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 1-[3-(3-imino-1H-isoindol-2-yl)phenyl]ethanone |
| InChIKey | WRDGMMDGYNHYCU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)N2CC3=CC=CC=C3C2=N |
Computed by PubChem (NCBI)