CAS 1365272-24-7 is the registry number for 4-(2-Cyanophenyl)-N,N-dimethylbenzamide, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-(2-cyanophenyl)-N,N-dimethylbenzamide (CAS 1365272-24-7) is a chemical compound with the molecular formula C16H14N2O and a molecular weight of 250.29 g/mol. IUPAC name: 4-(2-cyanophenyl)-N,N-dimethylbenzamide. InChIKey: HNEJRBSBVCTPJB-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 4-(2-cyanophenyl)-N,N-dimethylbenzamide |
| InChIKey | HNEJRBSBVCTPJB-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)C2=CC=CC=C2C#N |
Computed by PubChem (NCBI)