CAS 10198-89-7 appears in our catalog under these names: 1,3–Di(2–pyridyl)–1,3–propanedione, 1,3-Di(2-pyridyl)-1,3-propanedione, >98.0%(GC)(T), 1,3-DI(2-PYRIDYL)-1,3-PROPANEDIONE, 97%, 1,3-Di(pyridin-2-yl)propane-1,3-dione, 98%, 98%, 1,3-Di(pyridin-2-yl)propane-1,3-dione, 98%. Offered by: GLPBio, TCI, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100g.
1,3-dipyridin-2-ylpropane-1,3-dione (CAS 10198-89-7) is a chemical compound with the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. IUPAC name: 1,3-dipyridin-2-ylpropane-1,3-dione. InChIKey: DCGUVLMWGIPVDP-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 1,3-dipyridin-2-ylpropane-1,3-dione |
| InChIKey | DCGUVLMWGIPVDP-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)CC(=O)C2=CC=CC=N2 |
Computed by PubChem (NCBI)