CAS 102-65-8 appears in our catalog under these names: Sulfaclozine, 98%, Sulfaclozine sodium monohydrate, 95%, Sulfaclozine 1000 µg/mL in Acetonitrile, Sulfachloropyrazine, >95% (HPLC), Sulfaclozine/ 99.11% (existing batch purity). Offered by: Combi-blocks, Dr. Ehrenstorfer, TRC, TargetMol, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg, 1ml, 10mM (in 1ml dmso), 25g, Get quote.
4-amino-N-(6-chloropyrazin-2-yl)benzenesulfonamide (CAS 102-65-8) is a chemical compound with the molecular formula C10H9ClN4O2S and a molecular weight of 284.72 g/mol. IUPAC name: 4-amino-N-(6-chloropyrazin-2-yl)benzenesulfonamide. InChIKey: QKLPUVXBJHRFQZ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN4O2S |
|---|---|
| Molecular weight | 284.72 g/mol |
| IUPAC name | 4-amino-N-(6-chloropyrazin-2-yl)benzenesulfonamide |
| InChIKey | QKLPUVXBJHRFQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)NC2=CN=CC(=N2)Cl |
Computed by PubChem (NCBI)