CAS 1251716-80-9 is the registry number for 2-[(6-Chloro-2-methyl-4-pyrimidinyl)amino]-5-thiazolecarboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazole-5-carboxylate (CAS 1251716-80-9) is a chemical compound with the molecular formula C10H9ClN4O2S and a molecular weight of 284.72 g/mol. IUPAC name: methyl 2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazole-5-carboxylate. InChIKey: PWEKRDVMLSIHBF-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN4O2S |
|---|---|
| Molecular weight | 284.72 g/mol |
| IUPAC name | methyl 2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3-thiazole-5-carboxylate |
| InChIKey | PWEKRDVMLSIHBF-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)Cl)NC2=NC=C(S2)C(=O)OC |
Computed by PubChem (NCBI)