Products 1795037-54-5
CAS 1795037-54-5 appears in our catalog under these names: Sulfachlorpyridazine-d4, Sulfachlorpyridazine-d4, >95% (HPLC), Sulfachloropyridazine-d4, 99.0%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
4-amino-N-(6-chloropyridazin-3-yl)-2,3,5,6-tetradeuteriobenzenesulfonamide (CAS 1795037-54-5) is a chemical compound with the molecular formula C10H9ClN4O2S and a molecular weight of 288.75 g/mol. IUPAC name: 4-amino-N-(6-chloropyridazin-3-yl)-2,3,5,6-tetradeuteriobenzenesulfonamide. InChIKey: XOXHILFPRYWFOD-RHQRLBAQSA-N.
| Molecular formula | C10H9ClN4O2S |
|---|---|
| Molecular weight | 288.75 g/mol |
| IUPAC name | 4-amino-N-(6-chloropyridazin-3-yl)-2,3,5,6-tetradeuteriobenzenesulfonamide |
| InChIKey | XOXHILFPRYWFOD-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)NC2=NN=C(C=C2)Cl)[2H] |
Computed by PubChem (NCBI)