Products 1020252-30-5
CAS 1020252-30-5 is the registry number for N-(((1,3-dioxoindan-2-ylidene)ethyl)amino)-2-phenylethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[(E)-1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]-2-phenylacetamide (CAS 1020252-30-5) is a chemical compound with the molecular formula C19H16N2O3 and a molecular weight of 320.3 g/mol. IUPAC name: N-[(E)-1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]-2-phenylacetamide. InChIKey: OCEVYAXWJQUSDS-UDWIEESQSA-N.
| Molecular formula | C19H16N2O3 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | N-[(E)-1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]-2-phenylacetamide |
| InChIKey | OCEVYAXWJQUSDS-UDWIEESQSA-N |
| SMILES | C/C(=N\NC(=O)CC1=CC=CC=C1)/C2=C(C3=CC=CC=C3C2=O)O |
Computed by PubChem (NCBI)