CAS 1020252-40-7 is the registry number for 3-Phenylindeno(1,2-c)pyrazol-4(2H)-one. Offered by: Biosynth. Available pack sizes: 5000mg.
3-phenyl-1H-indeno[2,1-d]pyrazol-4-one (CAS 1020252-40-7) is a chemical compound with the molecular formula C16H10N2O and a molecular weight of 246.26 g/mol. IUPAC name: 3-phenyl-1H-indeno[2,1-d]pyrazol-4-one. InChIKey: WBJSAJUPDRXEPQ-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 3-phenyl-1H-indeno[2,1-d]pyrazol-4-one |
| InChIKey | WBJSAJUPDRXEPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC3=C2C(=O)C4=CC=CC=C43 |
Computed by PubChem (NCBI)