CAS 1637465-83-8 is the registry number for Dibenzo[f,h]quinazolin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1H-phenanthro[9,10-d]pyrimidin-2-one (CAS 1637465-83-8) is a chemical compound with the molecular formula C16H10N2O and a molecular weight of 246.26 g/mol. IUPAC name: 1H-phenanthro[9,10-d]pyrimidin-2-one. InChIKey: CIVBGLMVZGQCJN-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 1H-phenanthro[9,10-d]pyrimidin-2-one |
| InChIKey | CIVBGLMVZGQCJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C4=C2C=NC(=O)N4 |
Computed by PubChem (NCBI)