CAS 2089-82-9 appears in our catalog under these names: sAJM589, 98%, sAJM589, sAJM589, 99.65%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 2mg, 1mg, 10mg, 5mg, 25mg, 5 mg, 10mM/1mL.
Benzo[a]phenazin-5-ol (CAS 2089-82-9) is a chemical compound with the molecular formula C16H10N2O and a molecular weight of 246.26 g/mol. IUPAC name: benzo[a]phenazin-5-ol. InChIKey: WZBDRAAGHRCRKM-UHFFFAOYSA-N.
| Molecular formula | C16H10N2O |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | benzo[a]phenazin-5-ol |
| InChIKey | WZBDRAAGHRCRKM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC3=NC4=CC=CC=C4N=C23)O |
Computed by PubChem (NCBI)