Products 1020369-72-5
CAS 1020369-72-5 is the registry number for 5-Bromo-7-nitro-1H-indole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-7-nitro-1H-indole-2-carboxylic acid (CAS 1020369-72-5) is a chemical compound with the molecular formula C9H5BrN2O4 and a molecular weight of 285.05 g/mol. IUPAC name: 5-bromo-7-nitro-1H-indole-2-carboxylic acid. InChIKey: STTIMNPIMKGFID-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O4 |
|---|---|
| Molecular weight | 285.05 g/mol |
| IUPAC name | 5-bromo-7-nitro-1H-indole-2-carboxylic acid |
| InChIKey | STTIMNPIMKGFID-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(NC2=C(C=C1Br)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)