CAS 1178773-51-7 is the registry number for 3-(7-Bromo-1,3-dioxaindan-5-yl)-4,5-dihydro-1,2,4-oxadiazol-5-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(7-bromo-1,3-benzodioxol-5-yl)-4H-1,2,4-oxadiazol-5-one (CAS 1178773-51-7) is a chemical compound with the molecular formula C9H5BrN2O4 and a molecular weight of 285.05 g/mol. IUPAC name: 3-(7-bromo-1,3-benzodioxol-5-yl)-4H-1,2,4-oxadiazol-5-one. InChIKey: YESSWCDAIDOOMX-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O4 |
|---|---|
| Molecular weight | 285.05 g/mol |
| IUPAC name | 3-(7-bromo-1,3-benzodioxol-5-yl)-4H-1,2,4-oxadiazol-5-one |
| InChIKey | YESSWCDAIDOOMX-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)C3=NOC(=O)N3)Br |
Computed by PubChem (NCBI)