Products 2767590-08-7
CAS 2767590-08-7 is the registry number for 6-Bromopyrazolo[1,5-a]pyridine-3,4-dicarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromopyrazolo[1,5-a]pyridine-3,4-dicarboxylic acid (CAS 2767590-08-7) is a chemical compound with the molecular formula C9H5BrN2O4 and a molecular weight of 285.05 g/mol. IUPAC name: 6-bromopyrazolo[1,5-a]pyridine-3,4-dicarboxylic acid. InChIKey: DWHMFRGRQJEJLF-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O4 |
|---|---|
| Molecular weight | 285.05 g/mol |
| IUPAC name | 6-bromopyrazolo[1,5-a]pyridine-3,4-dicarboxylic acid |
| InChIKey | DWHMFRGRQJEJLF-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C=NN2C=C1Br)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)