Products 1020413-85-7
CAS 1020413-85-7 appears in our catalog under these names: Luciferase–IN–4, Luciferase-IN-4, 90.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg.
(E)-1-(4-chlorophenyl)-3-(pyridin-2-ylamino)prop-2-en-1-one (CAS 1020413-85-7) is a chemical compound with the molecular formula C14H11ClN2O and a molecular weight of 258.70 g/mol. IUPAC name: (E)-1-(4-chlorophenyl)-3-(pyridin-2-ylamino)prop-2-en-1-one. InChIKey: WXXHFZLFNUHSEB-CSKARUKUSA-N.
| Molecular formula | C14H11ClN2O |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | (E)-1-(4-chlorophenyl)-3-(pyridin-2-ylamino)prop-2-en-1-one |
| InChIKey | WXXHFZLFNUHSEB-CSKARUKUSA-N |
| SMILES | C1=CC=NC(=C1)N/C=C/C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)