CAS 1020719-47-4 is the registry number for 3-Hydroxyacetaminophen-D3, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
2,2,2-trideuterio-N-(3,4-dihydroxyphenyl)acetamide (CAS 1020719-47-4) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 170.18 g/mol. IUPAC name: 2,2,2-trideuterio-N-(3,4-dihydroxyphenyl)acetamide. InChIKey: IPFBMHOMTSBTSU-FIBGUPNXSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 170.18 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-(3,4-dihydroxyphenyl)acetamide |
| InChIKey | IPFBMHOMTSBTSU-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)