Products 1020719-51-0

CAS 1020719-51-0 is the registry number for 3-Hydroxy-2-methyl-d3-benzoic Acid. Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

3-hydroxy-2-(trideuteriomethyl)benzoic acid (CAS 1020719-51-0) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 155.17 g/mol. IUPAC name: 3-hydroxy-2-(trideuteriomethyl)benzoic acid. InChIKey: RIERSGULWXEJKL-FIBGUPNXSA-N.

Identity
Molecular formulaC8H8O3
Molecular weight155.17 g/mol
IUPAC name3-hydroxy-2-(trideuteriomethyl)benzoic acid
InChIKeyRIERSGULWXEJKL-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C1=C(C=CC=C1O)C(=O)O

Computed by PubChem (NCBI)