CAS 1020719-51-0 is the registry number for 3-Hydroxy-2-methyl-d3-benzoic Acid. Offered by: TRC. Available pack sizes: 100mg, 10mg.
3-hydroxy-2-(trideuteriomethyl)benzoic acid (CAS 1020719-51-0) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 155.17 g/mol. IUPAC name: 3-hydroxy-2-(trideuteriomethyl)benzoic acid. InChIKey: RIERSGULWXEJKL-FIBGUPNXSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 155.17 g/mol |
| IUPAC name | 3-hydroxy-2-(trideuteriomethyl)benzoic acid |
| InChIKey | RIERSGULWXEJKL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=CC=C1O)C(=O)O |
Computed by PubChem (NCBI)