CAS 1020719-60-1 is the registry number for 3-Methoxy-2-methyl-N-phenylbenzamide-d3. Offered by: TRC. Available pack sizes: 100mg, 10mg.
3-methoxy-N-phenyl-2-(trideuteriomethyl)benzamide (CAS 1020719-60-1) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 244.30 g/mol. IUPAC name: 3-methoxy-N-phenyl-2-(trideuteriomethyl)benzamide. InChIKey: JMYLVZGGEKBZAB-FIBGUPNXSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 244.30 g/mol |
| IUPAC name | 3-methoxy-N-phenyl-2-(trideuteriomethyl)benzamide |
| InChIKey | JMYLVZGGEKBZAB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=CC=C1OC)C(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)