CAS 1020719-72-5 appears in our catalog under these names: Penciclovir-d4, Penciclovir-d4, >95% (HPLC), Penciclovir-d4, 97.0%. Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 500 μg.
2-amino-9-[1,1,2,2-tetradeuterio-4-hydroxy-3-(hydroxymethyl)butyl]-1H-purin-6-one (CAS 1020719-72-5) is a chemical compound with the molecular formula C10H15N5O3 and a molecular weight of 257.28 g/mol. IUPAC name: 2-amino-9-[1,1,2,2-tetradeuterio-4-hydroxy-3-(hydroxymethyl)butyl]-1H-purin-6-one. InChIKey: JNTOCHDNEULJHD-LNLMKGTHSA-N.
| Molecular formula | C10H15N5O3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 2-amino-9-[1,1,2,2-tetradeuterio-4-hydroxy-3-(hydroxymethyl)butyl]-1H-purin-6-one |
| InChIKey | JNTOCHDNEULJHD-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C(CO)CO)C([2H])([2H])N1C=NC2=C1N=C(NC2=O)N |
Computed by PubChem (NCBI)