CAS 166197-79-1 is the registry number for Desdiacetyl-8-oxo Famciclovir. Offered by: TRC. Available pack sizes: 100mg.
2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7H-purin-8-one (CAS 166197-79-1) is a chemical compound with the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. IUPAC name: 2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7H-purin-8-one. InChIKey: ONASPHSEDMUZNH-UHFFFAOYSA-N.
| Molecular formula | C10H15N5O3 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | 2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-7H-purin-8-one |
| InChIKey | ONASPHSEDMUZNH-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=N1)N)N(C(=O)N2)CCC(CO)CO |
Computed by PubChem (NCBI)