Products 1346603-55-1
CAS 1346603-55-1 is the registry number for Desdiacetyl-8-oxo Famciclovir-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2-amino-9-[1,1,2,2-tetradeuterio-4-hydroxy-3-(hydroxymethyl)butyl]-7H-purin-8-one (CAS 1346603-55-1) is a chemical compound with the molecular formula C10H15N5O3 and a molecular weight of 257.28 g/mol. IUPAC name: 2-amino-9-[1,1,2,2-tetradeuterio-4-hydroxy-3-(hydroxymethyl)butyl]-7H-purin-8-one. InChIKey: ONASPHSEDMUZNH-LNLMKGTHSA-N.
| Molecular formula | C10H15N5O3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 2-amino-9-[1,1,2,2-tetradeuterio-4-hydroxy-3-(hydroxymethyl)butyl]-7H-purin-8-one |
| InChIKey | ONASPHSEDMUZNH-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C(CO)CO)C([2H])([2H])N1C2=NC(=NC=C2NC1=O)N |
Computed by PubChem (NCBI)
Synonyms:
Desdiacetyl-8-oxo Famciclovir-d4