CAS 1020955-20-7 appears in our catalog under these names: 3-(4-Ethylphenyl)-1,2-oxazol-5-amine, 95%, 5-Amino-3-(4-ethylphenyl)isoxazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g.
3-(4-ethylphenyl)-1,2-oxazol-5-amine (CAS 1020955-20-7) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 3-(4-ethylphenyl)-1,2-oxazol-5-amine. InChIKey: WZBGIZPUUZIMTP-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 3-(4-ethylphenyl)-1,2-oxazol-5-amine |
| InChIKey | WZBGIZPUUZIMTP-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=NOC(=C2)N |
Computed by PubChem (NCBI)