CAS 1020973-41-4 is the registry number for Cyclobutyl(2,4-difluorophenyl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclobutyl-(2,4-difluorophenyl)methanamine (CAS 1020973-41-4) is a chemical compound with the molecular formula C11H13F2N and a molecular weight of 197.22 g/mol. IUPAC name: cyclobutyl-(2,4-difluorophenyl)methanamine. InChIKey: HSHYNGLQYFODFZ-UHFFFAOYSA-N.
| Molecular formula | C11H13F2N |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | cyclobutyl-(2,4-difluorophenyl)methanamine |
| InChIKey | HSHYNGLQYFODFZ-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(C2=C(C=C(C=C2)F)F)N |
Computed by PubChem (NCBI)