CAS 1345471-75-1 is the registry number for 1-(2,4-Difluorophenyl)piperidine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(2,4-difluorophenyl)piperidine (CAS 1345471-75-1) is a chemical compound with the molecular formula C11H13F2N and a molecular weight of 197.22 g/mol. IUPAC name: 1-(2,4-difluorophenyl)piperidine. InChIKey: DZAKQIMUXDHLRT-UHFFFAOYSA-N.
| Molecular formula | C11H13F2N |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)piperidine |
| InChIKey | DZAKQIMUXDHLRT-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)