CAS 1215627-14-7 is the registry number for [1-(2,6-Difluorophenyl)cyclobutyl]methylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[1-(2,6-difluorophenyl)cyclobutyl]methanamine (CAS 1215627-14-7) is a chemical compound with the molecular formula C11H13F2N and a molecular weight of 197.22 g/mol. IUPAC name: [1-(2,6-difluorophenyl)cyclobutyl]methanamine. InChIKey: NRRUEPBXSVGHKQ-UHFFFAOYSA-N.
| Molecular formula | C11H13F2N |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | [1-(2,6-difluorophenyl)cyclobutyl]methanamine |
| InChIKey | NRRUEPBXSVGHKQ-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CN)C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)