Products 1020989-37-0
CAS 1020989-37-0 is the registry number for (2,5-Dichlorophenyl)(2,3-dihydro-1-benzofuran-5-yl)methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanamine (CAS 1020989-37-0) is a chemical compound with the molecular formula C15H13Cl2NO and a molecular weight of 294.2 g/mol. IUPAC name: (2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanamine. InChIKey: QDAAUAUXWSKBJM-UHFFFAOYSA-N.
| Molecular formula | C15H13Cl2NO |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | (2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanamine |
| InChIKey | QDAAUAUXWSKBJM-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C(C3=C(C=CC(=C3)Cl)Cl)N |
Computed by PubChem (NCBI)