CAS 19518-30-0 is the registry number for 1-(4-Chlorophenyl)-3-(3-methylpyridinium-1-yl)prop-2-en-1-one chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
(E)-1-(4-chlorophenyl)-3-(3-methylpyridin-1-ium-1-yl)prop-2-en-1-one chloride (CAS 19518-30-0) is a chemical compound with the molecular formula C15H13Cl2NO and a molecular weight of 294.2 g/mol. IUPAC name: (E)-1-(4-chlorophenyl)-3-(3-methylpyridin-1-ium-1-yl)prop-2-en-1-one chloride. InChIKey: PGQSMWBHJWEKPN-VRTOBVRTSA-M.
| Molecular formula | C15H13Cl2NO |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | (E)-1-(4-chlorophenyl)-3-(3-methylpyridin-1-ium-1-yl)prop-2-en-1-one chloride |
| InChIKey | PGQSMWBHJWEKPN-VRTOBVRTSA-M |
| SMILES | CC1=C[N+](=CC=C1)/C=C/C(=O)C2=CC=C(C=C2)Cl.[Cl-] |
Computed by PubChem (NCBI)